588732-72-3 Usage
Description
Furo[2,3-c]pyridin-7(6H)-one, 2,3-dihydro(9CI) is a heterocyclic compound characterized by a furo[2,3-c]pyridine core structure. It is recognized for its potential biological activities and is often utilized as a building block in the synthesis of pharmaceuticals and agrochemicals. This chemical's unique structure and reactivity contribute to its value in medicinal chemistry research and drug development.
Uses
Used in Pharmaceutical Industry:
Furo[2,3-c]pyridin-7(6H)-one, 2,3-dihydro(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals due to its potential biological activities. It may function as an anti-inflammatory, antifungal, or antitumor agent, making it a promising candidate for the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, Furo[2,3-c]pyridin-7(6H)-one, 2,3-dihydro(9CI) is employed as a building block for the creation of compounds with pesticidal properties. Its unique structure allows for the development of novel agrochemicals that can address specific needs in agriculture.
Used in Medicinal Chemistry Research:
Furo[2,3-c]pyridin-7(6H)-one, 2,3-dihydro(9CI) is utilized in medicinal chemistry research to explore its potential applications and properties. Further study and characterization are required to fully understand its capabilities and maximize its potential in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 588732-72-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,8,8,7,3 and 2 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 588732-72:
(8*5)+(7*8)+(6*8)+(5*7)+(4*3)+(3*2)+(2*7)+(1*2)=213
213 % 10 = 3
So 588732-72-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO2/c9-7-6-5(1-3-8-7)2-4-10-6/h1,3H,2,4H2,(H,8,9)
