58884-89-2 Usage
General Description
5-(5-chloro-2-thienyl)-1H-tetrazole is a chemical compound with the molecular formula C5H3ClN4S. It is a tetrazole derivative that contains a chlorothiophene group. 5-(5-CHLORO-2-THIENYL)-1H-TETRAZOLE is commonly used as a building block in the synthesis of various pharmaceuticals and agrochemicals. It exhibits anti-inflammatory and analgesic properties, and is also used as a building block for the synthesis of fungicides and herbicides. Additionally, it is also utilized in the development of new materials and in the production of dyes and pigments. 5-(5-CHLORO-2-THIENYL)-1H-TETRAZOLE is considered to be of high importance in the field of organic chemistry due to its versatile applications and potential in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 58884-89-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,8 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 58884-89:
(7*5)+(6*8)+(5*8)+(4*8)+(3*4)+(2*8)+(1*9)=192
192 % 10 = 2
So 58884-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN4S/c6-4-2-1-3(11-4)5-7-9-10-8-5/h1-2H,(H,7,8,9,10)