58905-46-7 Usage
Uses
Used in Pharmaceutical Development:
N1-[4-(CHLOROMETHYL)-1,3-THIAZOL-2-YL]-N1-(4-METHYLPHENYL)ACETAMIDE is used as a potential therapeutic agent for various medical conditions due to its unique structural features. Its thiazole ring, chloromethyl group, and methylphenyl group contribute to its potential as a building block in medicinal chemistry, making it a promising candidate for further exploration and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 58905-46-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,9,0 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 58905-46:
(7*5)+(6*8)+(5*9)+(4*0)+(3*5)+(2*4)+(1*6)=157
157 % 10 = 7
So 58905-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H13ClN2OS/c1-9-3-5-12(6-4-9)16(10(2)17)13-15-11(7-14)8-18-13/h3-6,8H,7H2,1-2H3