59039-67-7 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule of the compound.
Explanation
The trade name is a specific name given to the compound by the manufacturer or supplier for identification purposes.
Explanation
Diazepane derivatives are a class of organic compounds that contain a diazepane ring, which is a seven-membered ring with two nitrogen atoms.
Explanation
As a pharmaceutical intermediate, the compound is used in the synthesis of other pharmaceutical compounds, serving as a building block or precursor.
Explanation
The compound has potential applications in the development of new drugs and therapies, as well as in research to better understand biological processes and mechanisms.
Explanation
The compound's unique structure makes it a useful starting point for the development of new drugs, as it can be modified or combined with other molecules to create novel therapeutic agents.
Explanation
The compound has been investigated for its potential biological activities, which could lead to its use in the development of new treatments for various medical conditions.
Chemical Class
Diazepane derivative
Structural Feature
Contains a cyclohexyl ring
Primary Function
Pharmaceutical intermediate
Applications
Medical and research fields
Unique Chemical Structure
Valuable building block for synthesizing new drug candidates
Potential Bioactivities
Studied for various therapeutic applications
Check Digit Verification of cas no
The CAS Registry Mumber 59039-67-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,0,3 and 9 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 59039-67:
(7*5)+(6*9)+(5*0)+(4*3)+(3*9)+(2*6)+(1*7)=147
147 % 10 = 7
So 59039-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H22N2/c1-2-5-11(6-3-1)13-9-4-7-12-8-10-13/h11-12H,1-10H2
