59094-77-8 Usage
Uses
Used in the Food Industry:
Ethyl ethanethioate is utilized as a flavoring agent for its ability to impart specific tastes and aromas to food products, enhancing the overall sensory experience for consumers.
Used in the Fragrance Industry:
In the realm of fragrances, ethyl ethanethioate serves as a key component in the creation of various scents, leveraging its distinctive odor to contribute to the development of unique and appealing fragrances.
Used in Pharmaceutical Production:
Ethyl ethanethioate is employed as a precursor in the synthesis of pharmaceuticals, playing a crucial role in the development of new drugs and medicinal compounds due to its chemical reactivity and versatility.
Used in Organic Compound Synthesis:
Beyond its applications in the food, fragrance, and pharmaceutical sectors, ethyl ethanethioate is also used in the synthesis of other organic compounds, highlighting its importance in the broader field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 59094-77-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,0,9 and 4 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 59094-77:
(7*5)+(6*9)+(5*0)+(4*9)+(3*4)+(2*7)+(1*7)=158
158 % 10 = 8
So 59094-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H8OS/c1-3-6-4(2)5/h3H2,1-2H3
