59118-78-4 Usage
General Description
2-Mercaptoethyl oleate is a chemical compound that consists of a mercapto group and an oleic acid ester. It is commonly used as a surfactant and emulsifier in various industrial and personal care products. 2-Mercaptoethyl oleate is known for its ability to reduce the surface tension of liquids, making it useful in applications such as inks, coatings, and lubricants. Additionally, 2-Mercaptoethyl oleate has been studied for its potential use in the field of biotechnology, especially for its role in enhancing the stability and solubility of proteins and peptides. Overall, this chemical compound plays a significant role in various industries due to its surfactant and emulsifying properties.
Check Digit Verification of cas no
The CAS Registry Mumber 59118-78-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,1 and 8 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 59118-78:
(7*5)+(6*9)+(5*1)+(4*1)+(3*8)+(2*7)+(1*8)=144
144 % 10 = 4
So 59118-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H38O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(21)22-18-19-23/h9-10,23H,2-8,11-19H2,1H3/b10-9-
