59128-09-5 Usage
Uses
Used in Pharmaceutical Industry:
(7-METHYL-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as a building block for drug discovery and development due to its potential as a therapeutic agent. Its interaction with biological targets and pathways makes it a promising candidate for the treatment of various diseases and conditions.
Used in Medicinal Chemistry Research:
(7-METHYL-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as a valuable candidate for further research in the field of medicinal chemistry. Its unique chemical structure and properties allow scientists to explore its potential applications and optimize its therapeutic effects.
Used in Pharmaceutical Science:
(7-METHYL-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used in pharmaceutical science to study its potential as a drug candidate. Its biological activities and interactions with biological targets make it a promising compound for the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 59128-09-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,2 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59128-09:
(7*5)+(6*9)+(5*1)+(4*2)+(3*8)+(2*0)+(1*9)=135
135 % 10 = 5
So 59128-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2/c1-7-2-3-12-6-8(5-10(13)14)11-9(12)4-7/h2-4,6H,5H2,1H3,(H,13,14)
