59128-15-3 Usage
Uses
Used in Pharmaceutical Industry:
(6-BROMO-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as a building block for the synthesis of various biologically active molecules due to its imidazo[1,2-a]pyridine core, which is a common structural motif in many pharmaceutical compounds. Its unique chemical properties and the presence of the bromine atom at the 6th position may contribute to the development of new drugs with specific therapeutic effects.
Used in Drug Discovery:
(6-BROMO-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as a starting material in drug discovery for its potential to be modified and optimized to target specific biological pathways or receptors. The bromine atom can be replaced with other functional groups to explore different chemical and biological properties, enhancing the compound's therapeutic potential.
Used in Medicinal Chemistry Research:
(6-BROMO-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as a research tool in medicinal chemistry to study the structure-activity relationships of imidazo[1,2-a]pyridine-containing compounds. Understanding how modifications to the core structure affect biological activity can guide the design of more effective and selective drugs.
Used in Chemical Synthesis:
(6-BROMO-IMIDAZO[1,2-A]PYRIDIN-2-YL)-ACETIC ACID is used as an intermediate in the synthesis of more complex organic compounds, including potential drug candidates. Its reactivity and functional groups make it a versatile building block for creating a variety of chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59128-15-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,2 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59128-15:
(7*5)+(6*9)+(5*1)+(4*2)+(3*8)+(2*1)+(1*5)=133
133 % 10 = 3
So 59128-15-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O2/c10-6-1-2-8-11-7(3-9(13)14)5-12(8)4-6/h1-2,4-5H,3H2,(H,13,14)
