59150-78-6 Usage
Structure
A derivative of butyric acid containing a phenyl group with an amino and methylene substituent
Usage
Commonly used as a reagent in organic synthesis
Therapeutic potential
Being studied for its potential therapeutic properties in the field of medicine and pharmaceuticals
Industrial applications
Versatile compound with various potential applications in the chemical and biomedical industries
Check Digit Verification of cas no
The CAS Registry Mumber 59150-78-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,5 and 0 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 59150-78:
(7*5)+(6*9)+(5*1)+(4*5)+(3*0)+(2*7)+(1*8)=136
136 % 10 = 6
So 59150-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-2-9(11(13)14)6-8-4-3-5-10(12)7-8/h3-7H,2,12H2,1H3,(H,13,14)/b9-6+
