59221-81-7 Usage
Phenyl group
A phenyl group (C6H5) is attached to the bicyclic structure, providing additional stability and potentially influencing the compound's reactivity.
17-membered ring
The compound features a large ring with 17 atoms, which can affect its physical properties, such as solubility and flexibility.
Double bond at the 17th position
The presence of a double bond in the 17-membered ring can influence the compound's reactivity and potential applications in organic synthesis.
Ketone group at the 15th position
The ketone group (C=O) at the 15th position can participate in various chemical reactions, such as nucleophilic addition and enolate formation.
Azabicyclo family
As a member of the azabicyclo family, the compound exhibits unique physical and chemical properties due to the presence of nitrogen in the bicyclic structure.
Potential applications
The compound has potential applications in various fields, including pharmaceuticals, materials science, and organic synthesis.
Research and development interest
Due to its complex structure and potential applications, 16-phenyl-16-azabicyclo[10.4.0]hexadec-17-en-15-one is a molecule of interest for further research and development.
Physical properties
The compound's physical properties, such as melting point, boiling point, and solubility, can be influenced by its complex structure and the presence of various functional groups.
Chemical properties
The compound's chemical properties, such as reactivity, stability, and the ability to undergo specific reactions, are determined by its structure and the presence of functional groups, such as the phenyl group, double bond, and ketone group.
Check Digit Verification of cas no
The CAS Registry Mumber 59221-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,2 and 1 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59221-81:
(7*5)+(6*9)+(5*2)+(4*2)+(3*1)+(2*8)+(1*1)=127
127 % 10 = 7
So 59221-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H29NO/c23-21-17-16-18-12-8-5-3-1-2-4-6-11-15-20(18)22(21)19-13-9-7-10-14-19/h7,9-10,13-14H,1-6,8,11-12,15-17H2
