59229-09-3 Usage
Uses
Used in Chemical Synthesis:
2,4,6-Trimethylpyridinium p-Toluenesulfonate is used as a reagent in chemical synthesis for its ability to participate in various organic reactions, such as substitution, addition, and condensation reactions. Its unique structure and properties make it a valuable component in the synthesis of complex organic molecules and pharmaceutical compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4,6-Trimethylpyridinium p-Toluenesulfonate is used as an intermediate in the synthesis of various drugs and drug candidates. Its specific chemical properties allow it to be a key component in the development of new medications, potentially contributing to the treatment of various diseases and conditions.
Used in Research and Development:
2,4,6-Trimethylpyridinium p-Toluenesulfonate is also utilized in research and development settings, where it can be employed to study the properties and behavior of similar compounds. Its use in this context aids in the advancement of scientific knowledge and the discovery of new applications for related compounds.
Used in Analytical Chemistry:
In analytical chemistry, 2,4,6-Trimethylpyridinium p-Toluenesulfonate may be used as a reference compound or standard for the calibration of analytical instruments. Its well-defined chemical properties make it suitable for ensuring the accuracy and reliability of measurements in various chemical analyses.
Overall, 2,4,6-Trimethylpyridinium p-Toluenesulfonate is a versatile compound with a range of applications across different industries, particularly in chemical synthesis, pharmaceuticals, research and development, and analytical chemistry. Its unique properties and potential uses make it an important compound for further exploration and development.
Check Digit Verification of cas no
The CAS Registry Mumber 59229-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,2 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59229-09:
(7*5)+(6*9)+(5*2)+(4*2)+(3*9)+(2*0)+(1*9)=143
143 % 10 = 3
So 59229-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N.C7H8O3S/c1-6-4-7(2)9-8(3)5-6;1-6-2-4-7(5-3-6)11(8,9)10/h4-5H,1-3H3;2-5H,1H3,(H,8,9,10)
