59277-86-0 Usage
Chemical composition
The compound consists of a purine base (2,6-diaminopurine) attached to a methoxyethanol molecule.
Purine base
2,6-diaminopurine, a nitrogenous base found in DNA and RNA, and a precursor to compounds like caffeine and theobromine.
Methoxyethanol
A solvent commonly used in industrial and laboratory applications.
Potential applications
Biotechnology, pharmaceuticals, and organic chemistry due to the presence of the purine base, which plays a crucial role in various biological processes and can be used as a building block for other compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 59277-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,7 and 7 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 59277-86:
(7*5)+(6*9)+(5*2)+(4*7)+(3*7)+(2*8)+(1*6)=170
170 % 10 = 0
So 59277-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N6O2/c9-6-5-7(13-8(10)12-6)14(3-11-5)4-16-2-1-15/h3,15H,1-2,4H2,(H4,9,10,12,13)
59277-86-0Relevant articles and documents
2-Amido-9-(2-acyloxyethoxymethyl)hypoxanthines
-
, (2008/06/13)
Method of preparing 9-(2-hydroxyethoxymethyl)guanine which comprises preparing the compound STR1 wherein R and R1 are hydrogen, lower alkyl and phenyl and then hydrolyzing same. 9-(2-hydroxyethoxymethyl)guanine is useful as an antiviral.
