59288-39-0 Usage
Uses
Used in Pharmaceutical Industry:
3-Pyridinecarboxylic acid, 5-hydroxy-6-iodois used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a valuable building block for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
3-Pyridinecarboxylic acid, 5-hydroxy-6-iodois used as a key intermediate in the synthesis of various organic compounds. Its versatile functional groups allow for further chemical modifications and the formation of a wide range of derivatives with diverse properties and applications.
Used in Medicine:
3-Pyridinecarboxylic acid, 5-hydroxy-6-iodomay have potential applications in medicine due to its unique structure and functional groups. It could be used as a starting material for the development of new therapeutic agents or as a probe to study biological processes and pathways.
Used in Agrochemicals:
3-Pyridinecarboxylic acid, 5-hydroxy-6-iodomay find applications in the agrochemical industry as a precursor for the synthesis of various agrochemicals, such as pesticides, herbicides, and plant growth regulators. Its unique structure and functional groups could contribute to the development of novel and more effective agrochemicals.
Used in Material Science:
3-Pyridinecarboxylic acid, 5-hydroxy-6-iodomay have potential applications in material science due to its unique structure and functional groups. It could be used as a building block for the development of new materials with specific properties, such as conductive polymers, sensors, or catalysts.
Check Digit Verification of cas no
The CAS Registry Mumber 59288-39-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,8 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59288-39:
(7*5)+(6*9)+(5*2)+(4*8)+(3*8)+(2*3)+(1*9)=170
170 % 10 = 0
So 59288-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4INO3/c7-5-4(9)1-3(2-8-5)6(10)11/h1-2,9H,(H,10,11)
