59299-01-3 Usage
Uses
Used in Pharmaceutical Industry:
Uracil 5-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to be incorporated into the molecular structures of nucleoside drugs and antiviral agents.
Used in Medicinal Chemistry:
Uracil 5-carboxylic acid is used as a building block in the development of new drugs and therapeutic treatments, contributing to the advancement of medicinal chemistry and drug design.
Used in Chemical Intermediates:
Uracil 5-carboxylic acid is used as a versatile chemical intermediate in the production of a wide range of chemical compounds, facilitating the creation of novel substances with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 59299-01-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,9 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59299-01:
(7*5)+(6*9)+(5*2)+(4*9)+(3*9)+(2*0)+(1*1)=163
163 % 10 = 3
So 59299-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O4/c8-3-2(4(9)10)1-6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/p-1
