59301-22-3 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-Nitrophenyl)-4H-1,2,4-triazol-3-amine is used as a potential active pharmaceutical ingredient for its possible antimicrobial properties. Its unique structure may contribute to the development of new drugs targeting various microbial infections.
Used in Agrochemical Industry:
In the agrochemical sector, 5-(2-Nitrophenyl)-4H-1,2,4-triazol-3-amine is utilized as a candidate for antifungal agents. Its potential to combat fungal pathogens makes it a valuable compound for further research in crop protection and disease management.
Further research and testing are essential to fully explore the properties and potential applications of 5-(2-Nitrophenyl)-4H-1,2,4-triazol-3-amine in both the pharmaceutical and agrochemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 59301-22-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,3,0 and 1 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59301-22:
(7*5)+(6*9)+(5*3)+(4*0)+(3*1)+(2*2)+(1*2)=113
113 % 10 = 3
So 59301-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N5O2/c9-8-10-7(11-12-8)5-3-1-2-4-6(5)13(14)15/h1-4H,(H3,9,10,11,12)
