59301-25-6 Usage
Uses
Used in Pharmaceutical Drug Development:
5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine is used as a key intermediate in the synthesis of pharmaceuticals for its potential antifungal and antibacterial properties. Its unique chemical structure allows for the development of new drugs that can target a wide range of microbial infections.
Used in Research:
In the field of scientific research, 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine serves as a valuable compound for studying its biological activities and exploring its potential applications in medicine and other industries. Researchers utilize 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine to investigate its interactions with biological systems and to develop new methodologies for drug discovery.
Used in Organic Synthesis:
5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine is used as a building block in organic synthesis for creating novel compounds with diverse potential applications. Its unique structure allows chemists to modify and functionalize it, leading to the development of new molecules with specific properties and functions.
Used in Material Science:
In material science, 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine may find applications in the development of new materials with unique properties. Its chemical structure can be incorporated into polymers, coatings, or other materials to enhance their performance or introduce new functionalities.
Used in Agrochemicals:
5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine can be utilized in the development of agrochemicals, such as fungicides and bactericides, to protect crops from various diseases and pests. Its potential antifungal and antibacterial properties make it a promising candidate for use in agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59301-25-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,3,0 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59301-25:
(7*5)+(6*9)+(5*3)+(4*0)+(3*1)+(2*2)+(1*5)=116
116 % 10 = 6
So 59301-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN4/c9-6-4-2-1-3-5(6)7-11-8(10)13-12-7/h1-4H,(H3,10,11,12,13)
