5931-69-1 Usage
Molecular structure
2-(4-Fluoro-phenylimino)-3-methyl-4-oxo-[1,3]thiazinane-6-carboxylic acid has a complex molecular structure that includes a thiazine ring, a carboxylic acid group, a fluorine atom, and a methyl group.
Thiazine ring
The presence of a thiazine ring in the compound contributes to its potential biological activities and may be responsible for its potential antimicrobial or antifungal properties.
Carboxylic acid group
The carboxylic acid group is a functional group in the compound that plays a role in its reactivity and may contribute to its potential pharmaceutical applications.
Fluorine substituent
The presence of a fluorine atom in the compound can influence its chemical properties, such as reactivity and stability, and may contribute to its potential biological activities.
Potential applications
2-(4-Fluoro-phenylimino)-3-methyl-4-oxo-[1,3]thiazinane-6-carboxylic acid has potential applications in the pharmaceutical industry due to its promising biological activities.
Antimicrobial properties
The molecular structure of the compound suggests that it may have antimicrobial properties, making it a potentially valuable compound for the development of new medications to treat bacterial infections.
Antifungal properties
The compound's structure also suggests that it may have antifungal properties, which could be useful in the development of new medications to treat fungal infections.
Research and synthesis
The specific chemical properties of 2-(4-Fluoro-phenylimino)-3-methyl-4-oxo-[1,3]thiazinane-6-carboxylic acid make it an interesting target for further research and synthesis efforts, potentially leading to the discovery of new pharmaceutical compounds with improved properties.
Check Digit Verification of cas no
The CAS Registry Mumber 5931-69-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,3 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5931-69:
(6*5)+(5*9)+(4*3)+(3*1)+(2*6)+(1*9)=111
111 % 10 = 1
So 5931-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H11FN2O3S/c1-15-10(16)6-9(11(17)18)19-12(15)14-8-4-2-7(13)3-5-8/h2-5,9H,6H2,1H3,(H,17,18)/b14-12-
