59311-82-9 Usage
Uses
Used in Pharmaceutical Industry:
4-(benzylamino)-6-chloro-5-pyrimidinecarbaldehyde serves as a crucial intermediate in the synthesis of various pharmaceuticals. Its aldehyde group allows for a range of chemical reactions, enabling the formation of diverse drug molecules with potential therapeutic applications.
Used in Medicinal Chemistry Research:
In the realm of medicinal chemistry, 4-(benzylamino)-6-chloro-5-pyrimidinecarbaldehyde is employed as a versatile building block for the development of new biologically active compounds. Its unique structure and reactivity facilitate the design and synthesis of novel molecules with potential applications in treating various diseases and conditions.
Used in Organic Synthesis:
4-(benzylamino)-6-chloro-5-pyrimidinecarbaldehyde is utilized as a key component in organic synthesis, where its aldehyde functionality can be exploited to form a variety of chemical bonds and structures. This makes it a valuable asset for the synthesis of complex organic molecules and compounds with specific properties and functions.
Used in Drug Discovery:
As a building block in drug discovery, 4-(benzylamino)-6-chloro-5-pyrimidinecarbaldehyde contributes to the development of innovative therapeutic agents. Its unique molecular structure and reactivity allow researchers to explore new chemical spaces and identify potential drug candidates with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 59311-82-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,3,1 and 1 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59311-82:
(7*5)+(6*9)+(5*3)+(4*1)+(3*1)+(2*8)+(1*2)=129
129 % 10 = 9
So 59311-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClN3O/c13-11-10(7-17)12(16-8-15-11)14-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,14,15,16)
59311-82-9Relevant academic research and scientific papers
Convenient synthesis of novel pyrimido[4,5-b][1,5]benzothiazepines
Nikpour, Mohsen,Hasanzadeh, Neda
, p. 4380 - 4384 (2020/10/15)
Reaction of 4,6-dichloropyrimidine-5-carbaldehyde with amines in chloroform gave 4-(substitutedamino)-6-chloro-pyrimidine-5-carbaldehydes derivatives at low temperature. Treatment of the latter products with 2-aminobenzenethiol in alkaline benzene and the
Diverse display of non-covalent interacting elements using pyrimidine-embedded polyheterocycles
Choi, Yoona,Kim, Heejun,Shin, Young-Hee,Park, Seung Bum
supporting information, p. 13040 - 13043 (2015/08/06)
A series of pyrimidine-embedded polyheterocycles was synthesized using a pDOS strategy in a facile manner. The resulting poly-heterocyclic core skeletons containing a unique aza-tricyclic framework allowed for diverse display of non-covalent interacting e
