59396-51-9 Usage
Uses
Used in Pharmaceutical Industry:
(2-fluoro-5-methylphenyl) phenyl ketone is used as a synthetic intermediate for the development of pharmaceutical compounds. Its unique structure, including the presence of a fluorine atom and a methyl group, can contribute to the creation of new drugs with specific therapeutic properties.
Used in Chemical Industry:
In the chemical industry, (2-fluoro-5-methylphenyl) phenyl ketone is utilized as a building block for the synthesis of complex organic molecules. Its versatility in chemical reactions allows for the production of a wide range of specialty chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 59396-51-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,3,9 and 6 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59396-51:
(7*5)+(6*9)+(5*3)+(4*9)+(3*6)+(2*5)+(1*1)=169
169 % 10 = 9
So 59396-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11FO/c1-10-7-8-13(15)12(9-10)14(16)11-5-3-2-4-6-11/h2-9H,1H3
59396-51-9Relevant academic research and scientific papers
Process for the acylation of halo- or trihalomethylbenzenes
-
, (2008/06/13)
A process for the acylation of halo- or trihalomethylbenzenes, wherein a halo- or trihalomethylbenzene is reacted with a carboxylic acid, a precursor or a derivative thereof in the presence of boron trifluoride in an amount such that the absolute pressure of the boron trifluoride within the reaction vessel exceeds 1 bar, and in the presence of hydrofluoric acid as a solvent. The resultant products are useful as intermediates in the synthesis of compounds having a phytosanitary (e.g., herbicidal) or pharmaceutical activity.
