59455-10-6 Usage
Uses
Used in Pharmaceutical Research:
2,2-bis(4-fluorophenyl)tetrahydrofuran is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 2,2-bis(4-fluorophenyl)tetrahydrofuran serves as a valuable building block for the creation of complex organic molecules. Its presence in the synthesis process can lead to the formation of novel compounds with diverse applications.
Used in Drug Development:
2,2-bis(4-fluorophenyl)tetrahydrofuran is utilized as a starting material in the development of new drugs. Its unique properties and molecular structure contribute to the design and synthesis of innovative pharmaceutical products with potential therapeutic benefits.
It is important to handle 2,2-bis(4-fluorophenyl)tetrahydrofuran with care and follow standard safety protocols during its use, as it may have potential hazards associated with its application in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 59455-10-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,4,5 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 59455-10:
(7*5)+(6*9)+(5*4)+(4*5)+(3*5)+(2*1)+(1*0)=146
146 % 10 = 6
So 59455-10-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2O/c17-14-6-2-12(3-7-14)16(10-1-11-19-16)13-4-8-15(18)9-5-13/h2-9H,1,10-11H2
