59474-01-0 Usage
Uses
Used in Pharmaceutical Industry:
(10-METHYL-9-ANTHRACENYL) CARBAMIMIDOTHIOIC ACID METHYL ESTER HYDROCHLORIDE is used as a pharmaceutical agent for its ability to inhibit MDMX expression in breast cancer cells. By activating the p53 protein, (10-METHYL-9-ANTHRACENYL) CARBAMIMIDOTHIOIC ACID METHYL ESTER HYDROCHLORIDE promotes apoptosis, or programmed cell death, in cancer cells, making it a promising candidate for the development of anticancer drugs.
Used in Chemical Research:
In the field of chemical research, (10-METHYL-9-ANTHRACENYL) CARBAMIMIDOTHIOIC ACID METHYL ESTER HYDROCHLORIDE can be utilized as a starting material or intermediate for the synthesis of other complex organic compounds. Its unique structure and functional groups make it a valuable tool for exploring new chemical reactions and developing novel molecules with potential applications in various industries.
Used in Material Science:
(10-METHYL-9-ANTHRACENYL) CARBAMIMIDOTHIOIC ACID METHYL ESTER HYDROCHLORIDE's structural properties may also make it suitable for use in material science, where it could be employed in the development of new materials with specific characteristics. For example, its anthracenyl moiety could potentially be used to create materials with unique optical, electronic, or mechanical properties.
Biological Activity
Cell-permeable, genotype-selective antitumor agent that activates p53-dependent transcription. Increases levels of endogenous p53 in tumor cells and protects p53 from Mdm2-mediated degradation. Displays some selectivity for tumor cells vs. normal cells in an MTT cell viability assay.
Check Digit Verification of cas no
The CAS Registry Mumber 59474-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,4,7 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59474-01:
(7*5)+(6*9)+(5*4)+(4*7)+(3*4)+(2*0)+(1*1)=150
150 % 10 = 0
So 59474-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2S/c1-11-12-6-2-4-8-14(12)16(10-20-17(18)19)15-9-5-3-7-13(11)15/h2-9H,10H2,1H3,(H3,18,19)