59547-52-3 Usage
Uses
Used in Pharmaceutical Industry:
4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid is used as a potential therapeutic agent for various medical conditions due to its unique molecular structure and properties. Its dithiolane ring and pentyl amino acid chain may offer specific biological activities that can be harnessed for the development of new drugs.
Used in Materials Science:
In the field of materials science, 4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid is used as a component in the development of novel materials with specific properties. Its unique structure may contribute to the creation of materials with enhanced performance characteristics, such as improved stability, reactivity, or selectivity.
Used in Biochemistry Research:
4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid serves as a valuable research tool in biochemistry, where it can be employed to study the interactions between biomolecules and macromolecules. Its dithiolane ring and pentyl amino acid chain may facilitate the investigation of various biological processes and pathways.
Used in Medicinal Chemistry:
In medicinal chemistry, 4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid is used as a building block or a scaffold for the synthesis of new compounds with potential therapeutic applications. Its unique structure may provide a foundation for the development of innovative drugs with improved efficacy and selectivity.
Further research and studies are necessary to fully understand the properties and potential uses of 4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid in various scientific and industrial applications. Its unique molecular structure and potential applications across different fields highlight the importance of continued exploration and development of 4-[[5-(1,2-Dithiolan-3-yl)-1-oxopentyl]amino]butanoic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 59547-52-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,4 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59547-52:
(7*5)+(6*9)+(5*5)+(4*4)+(3*7)+(2*5)+(1*2)=163
163 % 10 = 3
So 59547-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H21NO3S2/c14-11(13-8-3-6-12(15)16)5-2-1-4-10-7-9-17-18-10/h10H,1-9H2,(H,13,14)(H,15,16)
59547-52-3Relevant academic research and scientific papers
MELANIN EXTINGUISHER
-
Page/Page column 7, (2008/06/13)
A melanin eliminator preparation comprising a metal chelate compound represented by the following formula (I), wherein M denotes a metal, and R denotes hydroxyl, O-lower alkyl, an amine bonded at N, an amino acid bonded at N, or a peptide bonded at N, or a pharmacologically acceptable salt thereof.
Dithiolan derivatives, their preparation and their therapeutic effect
-
, (2008/06/13)
A compound of formula (I): wherein one of m and n represents 0, and the other represents 0, 1 or 2; k represents 0 or 1 to 12; R1 is hydrogen, an aryl, a heterocyclic, an alkyl, a hydroxy or -OR7, wherein R7 is an alkyl, an alkenyl or an aralkyl; A is -CON(R2)SO2-, wherein R2 is hydrogen, an alkyl or an aralkyl; B is a single bond; and pharmaceutically acceptable salts thereof. The compounds have the ability to enhance the activity of glutathione reductase and can therefore be used for the treatment and prevention of a variety of diseases including cataracts.
