596-55-4 Usage
Uses
As the provided materials do not specify the exact uses of (4aR,12R)-2,3,4,4aβ,5,6,7,10-Octahydro-1,12-dimethyl-1H-5β,10bβ-propano-1,7-phenanthrolin-8(9H)-one, potential applications can be hypothesized based on its structure and properties:
Used in Pharmaceutical Industry:
(4aR,12R)-2,3,4,4aβ,5,6,7,10-Octahydro-1,12-dimethyl-1H-5β,10bβ-propano-1,7-phenanthrolin-8(9H)-one could be used as a chiral building block for the development of new pharmaceutical compounds. Its unique molecular structure may offer advantages in the synthesis of drugs with specific biological activities.
Used in Organic Synthesis:
In the field of organic synthesis, (4aR,12R)-2,3,4,4aβ,5,6,7,10-Octahydro-1,12-dimethyl-1H-5β,10bβ-propano-1,7-phenanthrolin-8(9H)-one may serve as a key intermediate or catalyst in the synthesis of complex organic molecules. Its chiral properties could be exploited to control the stereochemistry of reactions, leading to the production of enantiomerically pure compounds.
Used in Chemical Research:
(4aR,12R)-2,3,4,4aβ,5,6,7,10-Octahydro-1,12-dimethyl-1H-5β,10bβ-propano-1,7-phenanthrolin-8(9H)-one may be utilized in chemical research to study its reactivity, stability, and potential interactions with other molecules. This could provide valuable insights into its properties and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 596-55-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,9 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 596-55:
(5*5)+(4*9)+(3*6)+(2*5)+(1*5)=94
94 % 10 = 4
So 596-55-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H26N2O/c1-11-8-12-9-15-14(5-6-16(20)18-15)17(10-11)13(12)4-3-7-19(17)2/h11-13H,3-10H2,1-2H3,(H,18,20)/t11-,12-,13-,17+/m1/s1
