59673-82-4 Usage
Uses
Used in Pharmaceutical Synthesis:
Methyl 2-amino-4-(((2,5-dichlorophenyl)amino)carbonyl)benzoate is used as an intermediate in the synthesis of pharmaceuticals for its potential therapeutic applications in treating various diseases. Its unique structure allows for the development of new drugs with improved efficacy and safety profiles.
Used in Agrochemical Synthesis:
In the agrochemical industry, Methyl 2-amino-4-(((2,5-dichlorophenyl)amino)carbonyl)benzoate is used as a building block in the creation of pesticides and other agrochemicals. Its chemical properties contribute to the effectiveness of these products in protecting crops and enhancing agricultural productivity.
Used in Organic Synthesis and Chemical Research:
Methyl 2-amino-4-(((2,5-dichlorophenyl)amino)carbonyl)benzoate serves as a valuable compound in organic synthesis and chemical research. Its reactivity and structural features make it a useful component in the development of new organic compounds and the study of various chemical reactions and mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 59673-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,6,7 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59673-82:
(7*5)+(6*9)+(5*6)+(4*7)+(3*3)+(2*8)+(1*2)=174
174 % 10 = 4
So 59673-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H12Cl2N2O3/c1-22-15(21)10-4-2-8(6-12(10)18)14(20)19-13-7-9(16)3-5-11(13)17/h2-7H,18H2,1H3,(H,19,20)
