597551-56-9 Usage
Uses
Used in Pharmaceutical Research and Development:
4-Amino-2-chloro-5-iodopyrimidine is utilized as an intermediate in pharmaceutical research and development. It serves as a key component in the synthesis of various chemical compounds, contributing to the creation of new drugs and therapeutic agents.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-Amino-2-chloro-5-iodopyrimidine is employed as a building block for the development of novel compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science. Its unique structure allows for the formation of diverse derivatives, making it a valuable asset in the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 597551-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,9,7,5,5 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 597551-56:
(8*5)+(7*9)+(6*7)+(5*5)+(4*5)+(3*1)+(2*5)+(1*6)=209
209 % 10 = 9
So 597551-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H3ClIN3/c5-4-8-1-2(6)3(7)9-4/h1H,(H2,7,8,9)
