59772-58-6 Usage
Uses
Used in Pharmaceutical Industry:
6-Amino-pyridazine-3-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its potential biological and pharmacological activities. Its unique structure allows for the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Amino-pyridazine-3-carboxylic acid is used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, contributing to increased crop yields and agricultural productivity.
Used in Dye Industry:
6-Amino-pyridazine-3-carboxylic acid is utilized in the dye industry for the synthesis of various dyes with specific color properties. Its unique chemical structure allows for the creation of dyes with improved colorfastness and stability, making them suitable for various applications, including textiles, plastics, and printing inks.
Used in Material Science:
6-Amino-pyridazine-3-carboxylic acid serves as a potential building block in the design and synthesis of new organic materials and compounds. Its versatile chemical structure enables the development of materials with specific properties, such as conductivity, magnetism, or optical characteristics, which can be applied in various fields, including electronics, sensors, and energy storage.
Used in Antimicrobial Applications:
6-Amino-pyridazine-3-carboxylic acid has been studied for its potential antibacterial and antiviral properties. It can be used as an antimicrobial agent in various applications, such as in the development of antibiotics, antiviral drugs, and disinfectants, to combat resistant bacteria and viruses, thereby improving public health and reducing the spread of infectious diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 59772-58-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,7,7 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 59772-58:
(7*5)+(6*9)+(5*7)+(4*7)+(3*2)+(2*5)+(1*8)=176
176 % 10 = 6
So 59772-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H2,6,8)(H,9,10)
