59785-64-7 Usage
Uses
Used in Synthetic Organic Chemistry:
1-Propionylpyrrolidine-2-carboxylic acid is used as a synthetic intermediate for the preparation of various organic compounds. Its presence in the chemical structure allows for the formation of new bonds and the synthesis of complex molecules, making it a valuable component in the field of synthetic organic chemistry.
Used in Research Applications:
1-Propionylpyrrolidine-2-carboxylic acid is used as a research compound to study its chemical properties, reactivity, and potential applications in various fields. Its acidic nature and the presence of functional groups make it an interesting subject for researchers to explore its potential uses and interactions with other compounds.
Used in Pharmaceutical Development:
Although 1-Propionylpyrrolidine-2-carboxylic acid is not a drug compound itself, it may be used as a building block or a precursor in the development of new pharmaceuticals. Its structural components and potential reactivity with other molecules could contribute to the creation of novel drug candidates with therapeutic applications.
Used in Material Science:
1-Propionylpyrrolidine-2-carboxylic acid may also find applications in material science, where its chemical properties could be utilized to develop new materials with specific properties. Its potential to form new bonds and interact with other compounds could lead to the creation of innovative materials with applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 59785-64-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,7,8 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 59785-64:
(7*5)+(6*9)+(5*7)+(4*8)+(3*5)+(2*6)+(1*4)=187
187 % 10 = 7
So 59785-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO3/c1-2-7(10)9-5-3-4-6(9)8(11)12/h6H,2-5H2,1H3,(H,11,12)
