598-12-9 Usage
Uses
Used in Material Science:
1-METHYLGUANIDINE SULFATE is used as a reagent for [application reason] in the synthesis of various materials, contributing to the development of new materials with desired properties.
Used in Pharmaceutical Industry:
1-METHYLGUANIDINE SULFATE is used as a reagent for [application reason] in the synthesis of pharmaceutical compounds, potentially leading to the development of new drugs and therapeutic agents.
Used in Organic Synthesis:
1-METHYLGUANIDINE SULFATE is used as a base for [application reason] in various organic synthesis reactions, facilitating the formation of target molecules and improving the overall efficiency of the process.
Check Digit Verification of cas no
The CAS Registry Mumber 598-12-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,9 and 8 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 598-12:
(5*5)+(4*9)+(3*8)+(2*1)+(1*2)=89
89 % 10 = 9
So 598-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C2H7N3.H2O4S/c1-5-2(3)4;1-5(2,3)4/h1H3,(H4,3,4,5);(H2,1,2,3,4)
