59807-55-5 Usage
Uses
Used in Organic Synthesis:
2-(2-adamantyl)ethanamine serves as a key building block in the synthesis of various organic compounds. Its adamantane group provides a stable and rigid framework that can be further functionalized to create a wide array of chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(2-adamantyl)ethanamine is utilized as a starting material or intermediate in the development of new drugs. Its unique adamantane-based structure can be leveraged to design molecules with specific biological activities, potentially leading to the discovery of novel therapeutic agents.
Used in Drug Development:
2-(2-adamantyl)ethanamine is employed in drug development as a structural component that can influence the pharmacokinetic and pharmacodynamic properties of drug candidates. Its incorporation into drug molecules can enhance stability, solubility, and target binding, thereby improving the overall efficacy and safety of the resulting pharmaceuticals.
Used in Chemical Research and Development:
Beyond its applications in synthesis and drug discovery, 2-(2-adamantyl)ethanamine is also a valuable tool in chemical research and development. Its unique adamantane group can be studied to understand the effects of molecular structure on chemical reactivity, selectivity, and other properties, contributing to the advancement of chemical science.
Check Digit Verification of cas no
The CAS Registry Mumber 59807-55-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,8,0 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59807-55:
(7*5)+(6*9)+(5*8)+(4*0)+(3*7)+(2*5)+(1*5)=165
165 % 10 = 5
So 59807-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H21N/c13-2-1-12-10-4-8-3-9(6-10)7-11(12)5-8/h8-12H,1-7,13H2
