59850-84-9 Usage
Pharmaceuticals
May have potential as a drug candidate due to its unique structure and possible biological activity
Agrochemicals
Could be used as a component in pesticides or herbicides due to its potential reactivity and stability
Materials Science
May be incorporated into the development of new materials with specific properties, such as polymers or coatings
5. Ongoing Research
Scientists and researchers are actively exploring the specific properties and potential uses of 2,4,6-trichlorophenyl 5-oxo-L-prolinate
Further studies are needed to fully understand its potential applications and limitations in various industries
Check Digit Verification of cas no
The CAS Registry Mumber 59850-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,8,5 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 59850-84:
(7*5)+(6*9)+(5*8)+(4*5)+(3*0)+(2*8)+(1*4)=169
169 % 10 = 9
So 59850-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H8Cl3NO3/c12-5-3-6(13)10(7(14)4-5)18-11(17)8-1-2-9(16)15-8/h3-4,8H,1-2H2,(H,15,16)
