59866-21-6 Usage
General Description
2-oxobutanedioate, also known as oxalacetic acid or oxaloacetate, is a key intermediate in the citric acid cycle, which is the final common pathway for the oxidation of carbohydrates, fats, and proteins. It is a four-carbon molecule that plays a crucial role in energy metabolism by participating in the process of aerobic respiration in cells. Oxaloacetate is also involved in gluconeogenesis, the synthesis of glucose from non-carbohydrate sources, and it serves as a precursor for the biosynthesis of amino acids, particularly aspartate. Additionally, it is a critical component in the replenishment of the citric acid cycle by combining with acetyl-CoA to form citrate, thereby ensuring the continuous flow of metabolic intermediates in cellular energy production.
Check Digit Verification of cas no
The CAS Registry Mumber 59866-21-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,8,6 and 6 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59866-21:
(7*5)+(6*9)+(5*8)+(4*6)+(3*6)+(2*2)+(1*1)=176
176 % 10 = 6
So 59866-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H4O5.Mg/c5-2(4(8)9)1-3(6)7;/h1H2,(H,6,7)(H,8,9);/q;+2/p-2
