59907-13-0 Usage
Description
2-Bromo-3-fluorotoluene is an important organic intermediate with a unique molecular structure that features a bromine atom at the 2nd carbon position and a fluorine atom at the 3rd carbon position on a toluene ring. 2-BROMO-3-FLUOROTOLUENE possesses valuable chemical properties that make it a versatile building block in various chemical reactions and synthesis processes.
Uses
Used in Agrochemical Industry:
2-Bromo-3-fluorotoluene is used as a key intermediate in the synthesis of agrochemicals for its ability to contribute to the development of novel and effective pesticides and herbicides. Its unique structure allows for the creation of compounds with specific target pest profiles, enhancing crop protection and yield.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2-bromo-3-fluorotoluene serves as a crucial building block for the synthesis of various drug molecules. Its presence in the molecular structure can influence the pharmacokinetics, pharmacodynamics, and overall efficacy of the resulting pharmaceutical compounds, making it an essential component in drug discovery and development.
Used in Dye Industry:
2-Bromo-3-fluorotoluene is utilized as a vital intermediate in the production of dyes and pigments due to its ability to impart specific color characteristics and properties to the final product. Its unique structure allows for the creation of dyes with improved colorfastness, stability, and application versatility in various industries such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 59907-13-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,0 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 59907-13:
(7*5)+(6*9)+(5*9)+(4*0)+(3*7)+(2*1)+(1*3)=160
160 % 10 = 0
So 59907-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrF/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3
59907-13-0Relevant articles and documents
AZABENZOXAZOLES FOR THE TREATMENT OF CNS DISORDERS
-
Page/Page column 43, (2010/11/30)
The present invention relates to a7 nicotinic receptor agonists of formula (la) or (lb) as described herein and to a method for treating disorders of the Central Nervous System (CNS) and other disorders in a mammal, including a human, by administering to the mammal an a7 nicotinic receptor agonist of formula (la) or (lb). It also relates to pharmaceutical compositions containing a pharmaceutically acceptable carrier and a CNS-penetrant a7nicotinic receptor agonist of formula (la) or (lb).