59908-45-1 Usage
General Description
Lithium pyridine-2-carboxylate is a chemical compound formed by the combination of lithium and pyridine-2-carboxylic acid. It is used as a reagent in organic synthesis, particularly in the formation of complex organic compounds. Lithium pyridine-2-carboxylate is known for its ability to facilitate various reactions, including the deprotonation of acidic compounds and the formation of carbon-carbon bonds. It is also used as a catalyst in some reactions, particularly in the production of pharmaceuticals and agrochemicals. Additionally, lithium pyridine-2-carboxylate has been studied for its potential applications in materials science and as a precursor for the synthesis of other lithium-containing compounds. Overall, it is a versatile and important chemical in the field of organic chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 59908-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,0 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59908-45:
(7*5)+(6*9)+(5*9)+(4*0)+(3*8)+(2*4)+(1*5)=171
171 % 10 = 1
So 59908-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NO2.Li/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);/q;+1/p-1
