59914-91-9 Usage
General Description
6-beta-D-Glucopyranosyl-8-beta-D-xylopyranosylapigenin is a chemical compound that belongs to the flavones class of compounds. It is a flavonoid glycoside, which means it is a flavonoid compound with a sugar molecule attached to it. This specific compound is composed of apigenin, a naturally occurring flavonoid found in various plants, such as parsley, chamomile, and celery, bound to a glucose and xylose sugar molecules. Flavonoids are known for their antioxidant and anti-inflammatory properties, and they have been studied for potential health benefits, such as cardiovascular protection and anticancer effects. 6-beta-D-Glucopyranosyl-8-beta-D-xylopyranosylapigenin is a naturally occurring compound that can be found in certain plant sources and is being researched for its potential pharmacological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59914-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,1 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59914-91:
(7*5)+(6*9)+(5*9)+(4*1)+(3*4)+(2*9)+(1*1)=169
169 % 10 = 9
So 59914-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17+,18-,21+,22-,23-,25+,26+/m1/s1