59944-53-5 Usage
Uses
Used in Coordination Chemistry:
3,5-DIHEPTYL-1,2,4-TRIAZOL-4-YLAMINE is used as a ligand for the formation of coordination compounds. Its unique structure allows it to chelate with metal ions, facilitating the development of new complexes with potential applications in catalysis, sensing, and other areas.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 3,5-DIHEPTYL-1,2,4-TRIAZOL-4-YLAMINE is explored as a potential therapeutic agent. It has demonstrated anti-inflammatory and anti-cancer properties in some studies, making it a promising candidate for the development of new drugs targeting inflammatory diseases and various types of cancer.
Used in Materials Science:
3,5-DIHEPTYL-1,2,4-TRIAZOL-4-YLAMINE is utilized in the development of new polymers and functional materials. Its unique chemical structure contributes to the creation of materials with specific properties, such as improved thermal stability, mechanical strength, or electrical conductivity, which can be applied in various industries.
Used in Antimicrobial Applications:
3,5-DIHEPTYL-1,2,4-TRIAZOL-4-YLAMINE has also been investigated for its potential as an antimicrobial agent. 3,5-DIHEPTYL-1,2,4-TRIAZOL-4-YLAMINE shows promise in combating bacterial and fungal infections, which could lead to the development of new antimicrobial products for medical and industrial use.
Check Digit Verification of cas no
The CAS Registry Mumber 59944-53-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,4 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 59944-53:
(7*5)+(6*9)+(5*9)+(4*4)+(3*4)+(2*5)+(1*3)=175
175 % 10 = 5
So 59944-53-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H32N4/c1-3-5-7-9-11-13-15-18-19-16(20(15)17)14-12-10-8-6-4-2/h3-14,17H2,1-2H3