59944-75-1 Usage
Uses
Used in Pharmaceutical Industry:
Thieno[2,3-b]pyrazin-7-amine is used as a building block for the synthesis of various pharmaceuticals due to its unique chemical structure and properties. It serves as a key component in the development of new drugs for the treatment of various diseases and disorders.
Used in Agrochemical Industry:
Thieno[2,3-b]pyrazin-7-amine is also used as a building block for the synthesis of agrochemicals, contributing to the development of new compounds for agricultural applications, such as pesticides and herbicides.
Used in Medicinal Chemistry Research:
Thieno[2,3-b]pyrazin-7-amine is employed as a target for research in medicinal chemistry, where its unique structure and properties are investigated for potential therapeutic applications and biological activities, including antimicrobial and anticancer properties.
Used in Drug Discovery:
Thieno[2,3-b]pyrazin-7-amine is utilized in drug discovery processes, where its potential as a therapeutic agent is explored for the treatment of various diseases and disorders. Its chemical structure and properties make it a valuable candidate for the development of new drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 59944-75-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,4 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 59944-75:
(7*5)+(6*9)+(5*9)+(4*4)+(3*4)+(2*7)+(1*5)=181
181 % 10 = 1
So 59944-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3S/c7-4-3-10-6-5(4)8-1-2-9-6/h1-3H,7H2
