59961-21-6 Usage
General Description
1,2-dihydroisothiochromeno[4,3-c]pyrazol-3(5H)-one is a chemical compound that belongs to the isothiochromene family. It is a nitrogen-containing heterocycle that contains a pyrazole ring and a dihydroisothiochromene moiety. 1,2-dihydroisothiochromeno[4,3-c]pyrazol-3(5H)-one has potential pharmaceutical applications due to its structural features and biological activities. It is under study for its potential use as a drug candidate for various therapeutic applications. Its unique chemical structure makes it an interesting compound for medicinal chemistry research, and it may have potential as a lead compound for the development of new drugs. Further studies are being conducted to explore its biological properties and potential pharmacological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 59961-21-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,6 and 1 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59961-21:
(7*5)+(6*9)+(5*9)+(4*6)+(3*1)+(2*2)+(1*1)=166
166 % 10 = 6
So 59961-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2OS/c13-10-9-8(11-12-10)7-4-2-1-3-6(7)5-14-9/h1-4H,5H2,(H2,11,12,13)