60-17-3 Usage
Uses
Used in Scientific Research:
4-FLUORO-DL-PHENYLALANINE is used as a research compound for its unique properties in proteomics and protein engineering studies. The fluorination of this amino acid variant allows for the investigation of its effects on protein structure and function, as well as its potential applications in the development of new therapeutic agents.
Used in Drug Development:
4-FLUORO-DL-PHENYLALANINE is used as a potential therapeutic agent in the pharmaceutical industry. Its enhanced chemical properties, such as stability and binding affinity, make it a candidate for the development of new drugs, particularly in the areas of proteomics and protein engineering. The racemic mixture of D and L isomers may also provide insights into the different effects of each isomer on biological systems, potentially leading to the discovery of novel therapeutic targets.
Used in Chemical Synthesis:
4-FLUORO-DL-PHENYLALANINE is used as a building block in the synthesis of complex organic molecules. Its unique chemical properties, such as the presence of a fluorine atom, make it a valuable component in the creation of new compounds with potential applications in various fields, including medicine, materials science, and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 60-17-3 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 6 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 60-17:
(4*6)+(3*0)+(2*1)+(1*7)=33
33 % 10 = 3
So 60-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)
