6000-06-2 Usage
Molecular Weight
208.16 g/mol
Chemical Class
Carboxylic Acids
Hexahydro
Six hydrogen atoms are added to a molecule
1,3-dioxo
Two oxygen atoms are present in the form of a carbonyl group (C=O)
4,7-ethanoisobenzofuran
A fused ring system consisting of a benzene ring, a furan ring, and an ethano bridge
8-carboxylic acid
A carboxylic acid functional group (-COOH) is present at the 8th position
Biological Activity
Potential for exhibiting biological activity, with ongoing research
Research
Used in various scientific studies due to its unique structure
Industrial
Potential uses in the fields of organic chemistry and pharmaceuticals
Drug Molecule
Shows promise as a potential drug molecule due to its unique properties
Ongoing Research
Further investigation into its properties, applications, and potential uses is still being conducted
Check Digit Verification of cas no
The CAS Registry Mumber 6000-06-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,0 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6000-06:
(6*6)+(5*0)+(4*0)+(3*0)+(2*0)+(1*6)=42
42 % 10 = 2
So 6000-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O5/c12-9(13)6-3-4-1-2-5(6)8-7(4)10(14)16-11(8)15/h1-2,4-8H,3H2,(H,12,13)
