60081-73-4 Usage
Uses
Used in Specialty Chemicals Production:
4-Vinylbenzenesulfinic acid sodium salt is used as a key intermediate for the synthesis of specialty chemicals, contributing to the development of innovative products with specific properties tailored for various applications.
Used in Dye Manufacturing:
In the dye industry, 4-Vinylbenzenesulfinic acid sodium salt is utilized as a crucial component in the production of dyes. Its chemical structure allows for the creation of dyes with unique color characteristics and improved performance.
Used in Polymer Synthesis:
4-Vinylbenzenesulfinic acid sodium salt is employed as a monomer or a comonomer in the synthesis of polymers. Its presence in polymer formulations can enhance properties such as strength, flexibility, and durability.
Used as a Corrosion Inhibitor:
4-Vinylbenzenesulfinic acid sodium salt is used as a corrosion inhibitor in various applications, including industrial processes and the manufacturing of metal products. It helps protect metals from corrosion, extending their service life and improving overall performance.
Used in Organic Synthesis as a Reagent:
In organic synthesis, 4-Vinylbenzenesulfinic acid sodium salt serves as a valuable reagent, facilitating various chemical reactions and contributing to the synthesis of complex organic compounds.
Used in Pharmaceutical Manufacturing:
4-Vinylbenzenesulfinic acid sodium salt is utilized in the production of pharmaceuticals, where it plays a role in the synthesis of active pharmaceutical ingredients or serves as a key component in drug formulations.
Used in Agrochemical Production:
In the agrochemical industry, 4-Vinylbenzenesulfinic acid sodium salt is employed in the synthesis of various agrochemicals, such as pesticides and herbicides, contributing to the development of effective solutions for crop protection.
Used in Flavors and Fragrances Production:
4-Vinylbenzenesulfinic acid sodium salt is used in the manufacturing of flavors and fragrances, where it contributes to the creation of unique scents and taste profiles for various consumer products.
It is essential to handle 4-Vinylbenzenesulfinic acid sodium salt with care and follow proper safety protocols during its use to ensure the safety of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 60081-73-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,8 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 60081-73:
(7*6)+(6*0)+(5*0)+(4*8)+(3*1)+(2*7)+(1*3)=94
94 % 10 = 4
So 60081-73-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O2S.Na/c1-2-7-3-5-8(6-4-7)11(9)10;/h2-6H,1H2,(H,9,10);/q;+1/p-1
