6009-12-7 Usage
General Description
Confluentic acid is a naturally occurring chemical compound that has been isolated from the fermentation broth of the fungus Coniochaeta humosa. It belongs to the class of compounds known as polyketides, which are often characterized by their diverse biological activities. Confluentic acid has been found to possess potent cytotoxic and antifungal properties, making it a potential candidate for the development of new pharmaceuticals. Its unique chemical structure and promising bioactivity make it an interesting subject of research for the potential discovery of new drug leads and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 6009-12-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,0 and 9 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6009-12:
(6*6)+(5*0)+(4*0)+(3*9)+(2*1)+(1*2)=67
67 % 10 = 7
So 6009-12-7 is a valid CAS Registry Number.
InChI:InChI=1/C28H36O8/c1-5-7-9-11-18-14-22(17-24(35-4)26(18)27(31)32)36-28(33)25-19(13-20(29)12-10-8-6-2)15-21(34-3)16-23(25)30/h14-17,30H,5-13H2,1-4H3,(H,31,32)