60093-60-9 Usage
Uses
Used in Pharmaceutical Industry:
(2-Aminoanilino)acetonitrile is used as an intermediate in the synthesis of pharmaceuticals for its ability to form various organic compounds that contribute to the development of new drugs.
Used in Dye Industry:
(2-AMINOANILINO)ACETONITRILE is used as an intermediate in the production of dyes, where its unique structure allows for the creation of a wide range of colors and properties in dye formulations.
Used in Agrochemical Industry:
(2-Aminoanilino)acetonitrile is utilized as a building block in the synthesis of agrochemicals, contributing to the development of effective and innovative products for agricultural applications.
Used in Heterocyclic Compound Synthesis:
As a key building block, (2-Aminoanilino)acetonitrile is used in the synthesis of various heterocyclic compounds, which are important in the fields of pharmaceuticals, materials science, and other chemical industries.
Used in Coordination Chemistry:
(2-Aminoanilino)acetonitrile serves as a ligand in coordination chemistry, forming complexes with metal ions. This application is crucial in the development of new materials with specific properties and potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 60093-60-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,9 and 3 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 60093-60:
(7*6)+(6*0)+(5*0)+(4*9)+(3*3)+(2*6)+(1*0)=99
99 % 10 = 9
So 60093-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c9-5-6-11-8-4-2-1-3-7(8)10/h1-4,11H,6,10H2
