60189-97-1 Usage
Uses
Used in Pharmaceutical Industry:
Carbomethoxyformamidine HCl is used as a key intermediate in the synthesis of various pharmaceuticals, primarily for the production of antihypertensive drugs. Its role in the development of these medications is vital, as it contributes to the management and treatment of high blood pressure.
Used in Organic Synthesis:
In the field of organic synthesis, Carbomethoxyformamidine HCl is utilized for the production of other organic compounds. Its versatility in chemical reactions allows for the creation of a wide range of substances, expanding its applications beyond the pharmaceutical industry.
Used as a Catalyst in Chemical Reactions:
Carbomethoxyformamidine HCl also serves as a catalyst in certain chemical reactions, enhancing the efficiency and speed of these processes. Its catalytic properties make it a valuable component in various industrial applications, further demonstrating its importance in the chemical and pharmaceutical sectors.
Safety Precautions:
Due to its potential hazards if mishandled or ingested, Carbomethoxyformamidine HCl is typically handled and used in laboratory settings under strict safety procedures. It is essential to follow proper guidelines and protocols when working with this chemical compound to ensure the safety of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 60189-97-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,1,8 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 60189-97:
(7*6)+(6*0)+(5*1)+(4*8)+(3*9)+(2*9)+(1*7)=131
131 % 10 = 1
So 60189-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C3H6N2O2.ClH/c1-7-3(6)2(4)5;/h1H3,(H3,4,5);1H
