6020-54-8 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DIAMINO-5-PHENYLTHIAZOLE MONOHYDROBROMIDE is used as a key intermediate in the synthesis of antiallergic and anti-inflammatory agents. Its unique chemical structure allows it to modulate biological pathways and target specific receptors, providing relief from allergic reactions and inflammation.
2,4-DIAMINO-5-PHENYLTHIAZOLE MONOHYDROBROMIDE's ability to act on various physiological processes makes it a valuable asset in the development of new medications for treating a range of conditions, including but not limited to, asthma, rhinitis, dermatitis, and other inflammatory disorders. Its use in the pharmaceutical industry is primarily due to its potential to contribute to the creation of effective therapeutic agents that can improve patient outcomes and quality of life.
Check Digit Verification of cas no
The CAS Registry Mumber 6020-54-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,2 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6020-54:
(6*6)+(5*0)+(4*2)+(3*0)+(2*5)+(1*4)=58
58 % 10 = 8
So 6020-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3S.BrH/c10-8-7(13-9(11)12-8)6-4-2-1-3-5-6;/h1-5H,10H2,(H2,11,12);1H
