60207-30-9 Usage
Uses
Used in Organic Synthesis:
2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane is used as a building block for the synthesis of complex organic molecules. Its presence of a bromomethyl group allows for the introduction of a reactive functional group, facilitating the creation of a wide range of chemical products.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane is used as an intermediate in the production of pharmaceuticals. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane is also utilized in the agrochemical sector as an intermediate for the synthesis of agrochemicals. Its role in the production of these chemicals is crucial for the development of effective crop protection products.
Used in Specialty Chemicals:
2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane is employed in the synthesis of specialty chemicals, which are used in various industries such as plastics, coatings, and adhesives. The versatility of 2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane makes it a key component in the formulation of these high-value products.
It is important to handle 2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane with caution due to its potential hazards and reactivity. Proper safety measures should be taken to minimize risks during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 60207-30-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,2,0 and 7 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 60207-30:
(7*6)+(6*0)+(5*2)+(4*0)+(3*7)+(2*3)+(1*0)=79
79 % 10 = 9
So 60207-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrCl2O2/c11-6-10(14-3-4-15-10)8-2-1-7(12)5-9(8)13/h1-2,5H,3-4,6H2
