602262-86-2 Usage
Description
2,6-Dichlorophenethylisocyanide, with the molecular formula C9H7Cl2N, is an isocyanide compound characterized by the presence of two chlorine atoms and a phenethyl group. It is recognized for its strong, pungent odor and is utilized as a significant building block in organic synthesis, particularly for the production of pharmaceuticals and other organic compounds. Due to its toxic and potentially hazardous nature, care must be exercised during its handling. This chemical plays a vital role in the realm of organic chemistry and is employed across various industrial applications.
Uses
Used in Pharmaceutical Industry:
2,6-Dichlorophenethylisocyanide is used as a key intermediate in the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for versatile chemical reactions, facilitating the creation of a wide range of medicinal compounds.
Used in Organic Synthesis:
In the field of organic chemistry, 2,6-Dichlorophenethylisocyanide serves as a valuable building block for the production of diverse organic compounds. Its reactivity and functional groups enable chemists to construct complex molecules for various applications, including materials science, agrochemicals, and specialty chemicals.
Used in Research and Development:
2,6-Dichlorophenethylisocyanide is also utilized in research and development settings to explore new chemical reactions and investigate the properties of isocyanide compounds. Its presence in experimental procedures can lead to advancements in understanding organic reactions and the discovery of novel chemical entities.
Overall, 2,6-Dichlorophenethylisocyanide is a multifaceted chemical with applications spanning across the pharmaceutical, organic synthesis, and research industries, making it an indispensable component in the development of new and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 602262-86-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,2,2,6 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 602262-86:
(8*6)+(7*0)+(6*2)+(5*2)+(4*6)+(3*2)+(2*8)+(1*6)=122
122 % 10 = 2
So 602262-86-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7Cl2N/c1-12-6-5-7-8(10)3-2-4-9(7)11/h2-4H,5-6H2