603122-80-1 Usage
General Description
Methyl 4-borono-3-chlorobenzoate is a chemical compound with the molecular formula C8H7BClO3. It is a boronic ester derivative with a boron atom attached to the benzene ring. Methyl 4-borono-3-chlorobenzoate is commonly used in organic synthesis as a reagent in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Methyl 4-borono-3-chlorobenzoate is known for its ability to form stable and selective complexes with diols and amines, making it a valuable tool in the field of organic chemistry. Additionally, its boron atom makes it highly reactive towards nucleophiles, allowing for the formation of carbon-carbon and carbon-heteroatom bonds. Overall, Methyl 4-borono-3-chlorobenzoate is an important and versatile compound with various applications in chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 603122-80-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,3,1,2 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 603122-80:
(8*6)+(7*0)+(6*3)+(5*1)+(4*2)+(3*2)+(2*8)+(1*0)=101
101 % 10 = 1
So 603122-80-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BClO4/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,12-13H,1H3
