60404-18-4 Usage
Uses
Used in Organic Synthesis:
3-BROMO-2,5-DICHLOROTHIOPHENE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of new chemical compositions, contributing to the development of novel materials and products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-BROMO-2,5-DICHLOROTHIOPHENE serves as a valuable building block for the design and synthesis of new drug candidates. Its properties and reactivity enable the creation of innovative therapeutic agents with potential applications in various medical fields.
Check Digit Verification of cas no
The CAS Registry Mumber 60404-18-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,4,0 and 4 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 60404-18:
(7*6)+(6*0)+(5*4)+(4*0)+(3*4)+(2*1)+(1*8)=84
84 % 10 = 4
So 60404-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H
60404-18-4Relevant academic research and scientific papers
2-AMINO-N-(AMINO-OXO-ARYL-LAMBDA6-SULFANYLIDENE)ACETAMIDE COMPOUNDS AND THEIR THERAPEUTIC USE
-
Page/Page column 106, (2021/06/26)
The present invention pertains generally to the field of therapeutic compounds. More specifically the present invention pertains to certain 2-amino-N-(amino-oxo-aryl-λ6- sulfanylidene)acetamide compounds (referred to herein as ANASIA compounds) that, inter alia, inhibit (e.g., selectively inhibit) bacterial aminoacyl-tRNA synthetase (aaRS) (e.g., bacterial leucyl-tRNA synthetase, LeuRS). The present invention also pertains to pharmaceutical compositions comprising such compounds, and the use of such compounds and compositions, both in vitro and in vivo, to inhibit (e.g., selectively inhibit) bacterial aminoacyl-tRNA synthetase; to treat disorders that are ameliorated by the inhibition (e.g., selective inhibition) of bacterial aminoacyl-tRNA synthetase; to treat bacterial infections; etc.
