60462-36-4 Usage
Role
Intermediate in the synthesis of pharmaceuticals and agrochemicals
Applications
Potential applications in medicinal chemistry
Biological Activities
Anti-inflammatory: Studied for its potential as an anti-inflammatory agent
Anti-cancer: Investigated for its potential as an anti-cancer agent
Antibacterial: Investigated for antibacterial properties
Antiviral: Investigated for antiviral properties
Structure
Contains an amino group (2-amino)
Contains a cyclohexylamino group (cyclohexylamino)
Pyrimidine ring structure
Ketone functional group (4-one)
Research Interest
Due to its unique structure and diverse potential pharmacological activities, it is a compound of interest for further research and potential drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 60462-36-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,4,6 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 60462-36:
(7*6)+(6*0)+(5*4)+(4*6)+(3*2)+(2*3)+(1*6)=104
104 % 10 = 4
So 60462-36-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N4O/c11-10-13-8(6-9(15)14-10)12-7-4-2-1-3-5-7/h6-7H,1-5H2,(H4,11,12,13,14,15)
60462-36-4Relevant articles and documents
Alkylpurines as immunopotentiating agents. Synthesis and antiviral activity of certain alkylguanines.
Michael,Cottam,Smee,Robins,Kini
, p. 3431 - 3436 (2007/10/02)
Several simple 8-substituted 9-alkyl- and 7,8-disubstituted 9-alkylguanine derivatives were synthesized as potential antiviral agents. These were tested for antiviral protection against a lethal Semliki Forest virus (SFV) infection in mice, and their anti
