604799-95-3 Usage
General Description
1-(3-Methoxyphenyl)cyclopropanamine is a chemical compound belonging to the class of organic compounds known as aniline and substituted anilines. 1-(3-METHOXYPHENYL)CYCLOPROPANAMINE is characterized by the presence of a benzene ring, a cyclopropane ring and an amine group, making it a derivative of both aniline and cyclopropylamine. The "3-Methoxyphenyl" signifies that a methoxy group (-OCH3) is attached to the benzene ring at the third carbon atom. 1-(3-METHOXYPHENYL)CYCLOPROPANAMINE is used in the field of organic chemistry for various synthesis processes. However, specific data regarding its physical properties, toxicity, and potential applications are not widely available, indicating it is likely not a common or widely used substance.
Check Digit Verification of cas no
The CAS Registry Mumber 604799-95-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,0,4,7,9 and 9 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 604799-95:
(8*6)+(7*0)+(6*4)+(5*7)+(4*9)+(3*9)+(2*9)+(1*5)=193
193 % 10 = 3
So 604799-95-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO/c1-12-9-4-2-3-8(7-9)10(11)5-6-10/h2-4,7H,5-6,11H2,1H3
